תקציר
It seemed plausible that tri- and tetraamine ligands with a substituent which binds to Cu(I) but not to Cu(II), e.g., an allyl, stabilize Cu(I) in aqueous solutions and shift its redox potential cathodically relative to Cu+(aq). Therefore, the ligands N(CH2CH2NR2)2(CH2CH2NRCH2CH=CH2) (R = H or CH3) were synthesized. These ligands indeed stabilize Cu(I) in aqueous solutions and shift the redox potential of the Cu(II)/Cu(I) and Cu(I)/Cu(O) couples cathodically relative to Cu(2+/+)(aq) and the complexes Cu(II)L/Cu(I)L where L = R2NCH2CH2NRCH2CH2NR(CH2CH2=CH2). Therefore, the copper complexes with the new ligands are expected to be better catalysts to processes in which the redox step is the rate-determining step.
| שפה מקורית | אנגלית |
|---|---|
| עמודים (מ-עד) | 3536-3540 |
| מספר עמודים | 5 |
| כתב עת | Industrial and Engineering Chemistry Research |
| כרך | 39 |
| מספר גיליון | 10 |
| מזהי עצם דיגיטלי (DOIs) | |
| סטטוס פרסום | פורסם - 2000 |
טביעת אצבע
להלן מוצגים תחומי המחקר של הפרסום 'Design of ligands which improve Cu(I) catalysis'. יחד הם יוצרים טביעת אצבע ייחודית.פורמט ציטוט ביבליוגרפי
- APA
- Author
- BIBTEX
- Harvard
- Standard
- RIS
- Vancouver