تخطي إلى التنقل الرئيسي تخطي إلى البحث تخطي إلى المحتوى الرئيسي

Design of ligands which improve Cu(I) catalysis

نتاج البحث: نشر في مجلةمقالةمراجعة النظراء

17 اقتباسات (Scopus)

ملخص

It seemed plausible that tri- and tetraamine ligands with a substituent which binds to Cu(I) but not to Cu(II), e.g., an allyl, stabilize Cu(I) in aqueous solutions and shift its redox potential cathodically relative to Cu+(aq). Therefore, the ligands N(CH2CH2NR2)2(CH2CH2NRCH2CH=CH2) (R = H or CH3) were synthesized. These ligands indeed stabilize Cu(I) in aqueous solutions and shift the redox potential of the Cu(II)/Cu(I) and Cu(I)/Cu(O) couples cathodically relative to Cu(2+/+)(aq) and the complexes Cu(II)L/Cu(I)L where L = R2NCH2CH2NRCH2CH2NR(CH2CH2=CH2). Therefore, the copper complexes with the new ligands are expected to be better catalysts to processes in which the redox step is the rate-determining step.

اللغة الأصليةالإنجليزيّة
الصفحات (من إلى)3536-3540
عدد الصفحات5
دوريةIndustrial and Engineering Chemistry Research
مستوى الصوت39
رقم الإصدار10
المعرِّفات الرقمية للأشياء
حالة النشرنُشِر - 2000

بصمة

أدرس بدقة موضوعات البحث “Design of ligands which improve Cu(I) catalysis'. فهما يشكلان معًا بصمة فريدة.

قم بذكر هذا